C20H18FN3O4S2 — CID 50838911
N-(4-ethoxyphenyl)-2-[6-(3-fluorophenyl)sulfonylpyridazin-3-yl]sulfanylacetamide (PubChem CID 50838911) has the molecular formula C20H18FN3O4S2 and a molecular weight of 447.51 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[6-(3-fluorophenyl)sulfonylpyridazin-3-yl]sulfanylacetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[6-(3-fluorophenyl)sulfonylpyridazin-3-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 50838911 |
| Molecular Formula | C20H18FN3O4S2 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[6-(3-fluorophenyl)sulfonylpyridazin-3-yl]sulfanylacetamide |
| SMILES | CCOc1ccc(NC(=O)CSc2ccc(S(=O)(=O)c3cccc(F)c3)nn2)cc1 |
| InChI | InChI=1S/C20H18FN3O4S2/c1-2-28-16-8-6-15(7-9-16)22-18(25)13-29-19-10-11-20(24-23-19)30(26,27)17-5-3-4-14(21)12-17/h3-12H,2,13H2,1H3,(H,22,25) |
| InChIKey | MABVOQREYYPWSP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |