C20H19N3O5S3 — CID 50838874
2-[6-(4-methylphenyl)sulfonylpyridazin-3-yl]sulfanyl-N-(4-methylsulfonylphenyl)acetamide (PubChem CID 50838874) has the molecular formula C20H19N3O5S3 and a molecular weight of 477.59 g/mol. Its IUPAC name is 2-[6-(4-methylphenyl)sulfonylpyridazin-3-yl]sulfanyl-N-(4-methylsulfonylphenyl)acetamide.
| Compound Name | 2-[6-(4-methylphenyl)sulfonylpyridazin-3-yl]sulfanyl-N-(4-methylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 50838874 |
| Molecular Formula | C20H19N3O5S3 |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | 2-[6-(4-methylphenyl)sulfonylpyridazin-3-yl]sulfanyl-N-(4-methylsulfonylphenyl)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(SCC(=O)Nc3ccc(S(C)(=O)=O)cc3)nn2)cc1 |
| InChI | InChI=1S/C20H19N3O5S3/c1-14-3-7-17(8-4-14)31(27,28)20-12-11-19(22-23-20)29-13-18(24)21-15-5-9-16(10-6-15)30(2,25)26/h3-12H,13H2,1-2H3,(H,21,24) |
| InChIKey | ULAZOTOWIDKTIN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |