C18H20ClN3O3S2 — CID 22425636
N-(4-chlorophenyl)-2-(6-cyclohexylsulfonylpyridazin-3-yl)sulfanylacetamide (PubChem CID 22425636) has the molecular formula C18H20ClN3O3S2 and a molecular weight of 425.96 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(6-cyclohexylsulfonylpyridazin-3-yl)sulfanylacetamide.
| Compound Name | N-(4-chlorophenyl)-2-(6-cyclohexylsulfonylpyridazin-3-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 22425636 |
| Molecular Formula | C18H20ClN3O3S2 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | N-(4-chlorophenyl)-2-(6-cyclohexylsulfonylpyridazin-3-yl)sulfanylacetamide |
| SMILES | O=C(CSc1ccc(S(=O)(=O)C2CCCCC2)nn1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H20ClN3O3S2/c19-13-6-8-14(9-7-13)20-16(23)12-26-17-10-11-18(22-21-17)27(24,25)15-4-2-1-3-5-15/h6-11,15H,1-5,12H2,(H,20,23) |
| InChIKey | BPTSFMGLQZIOGA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |