C19H20BrNO3S2 — CID 39178437
2-(4-bromophenyl)sulfanyl-N-(4-cyclopentylsulfonylphenyl)acetamide (PubChem CID 39178437) has the molecular formula C19H20BrNO3S2 and a molecular weight of 454.41 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-N-(4-cyclopentylsulfonylphenyl)acetamide.
| Compound Name | 2-(4-bromophenyl)sulfanyl-N-(4-cyclopentylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 39178437 |
| Molecular Formula | C19H20BrNO3S2 |
| Molecular Weight | 454.41 g/mol |
| Exact Mass | 453.01 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-N-(4-cyclopentylsulfonylphenyl)acetamide |
| SMILES | O=C(CSc1ccc(Br)cc1)Nc1ccc(S(=O)(=O)C2CCCC2)cc1 |
| InChI | InChI=1S/C19H20BrNO3S2/c20-14-5-9-16(10-6-14)25-13-19(22)21-15-7-11-18(12-8-15)26(23,24)17-3-1-2-4-17/h5-12,17H,1-4,13H2,(H,21,22) |
| InChIKey | MKHOGMQKANZYFO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |