C19H20N2O5S2 — CID 39209515
N-(3-cyclopentylsulfonylphenyl)-2-(4-nitrophenyl)sulfanylacetamide (PubChem CID 39209515) has the molecular formula C19H20N2O5S2 and a molecular weight of 420.51 g/mol. Its IUPAC name is N-(3-cyclopentylsulfonylphenyl)-2-(4-nitrophenyl)sulfanylacetamide.
| Compound Name | N-(3-cyclopentylsulfonylphenyl)-2-(4-nitrophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 39209515 |
| Molecular Formula | C19H20N2O5S2 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | N-(3-cyclopentylsulfonylphenyl)-2-(4-nitrophenyl)sulfanylacetamide |
| SMILES | O=C(CSc1ccc([N+](=O)[O-])cc1)Nc1cccc(S(=O)(=O)C2CCCC2)c1 |
| InChI | InChI=1S/C19H20N2O5S2/c22-19(13-27-16-10-8-15(9-11-16)21(23)24)20-14-4-3-7-18(12-14)28(25,26)17-5-1-2-6-17/h3-4,7-12,17H,1-2,5-6,13H2,(H,20,22) |
| InChIKey | OKAPSYPIZXSTJT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|