C20H20FN3O — CID 50840809
[1-(3-fluorophenyl)indazol-3-yl]-(4-methylpiperidin-1-yl)methanone (PubChem CID 50840809) has the molecular formula C20H20FN3O and a molecular weight of 337.40 g/mol. Its IUPAC name is [1-(3-fluorophenyl)indazol-3-yl]-(4-methylpiperidin-1-yl)methanone.
| Compound Name | [1-(3-fluorophenyl)indazol-3-yl]-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 50840809 |
| Molecular Formula | C20H20FN3O |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | [1-(3-fluorophenyl)indazol-3-yl]-(4-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)c2nn(-c3cccc(F)c3)c3ccccc23)CC1 |
| InChI | InChI=1S/C20H20FN3O/c1-14-9-11-23(12-10-14)20(25)19-17-7-2-3-8-18(17)24(22-19)16-6-4-5-15(21)13-16/h2-8,13-14H,9-12H2,1H3 |
| InChIKey | YLKDMFJSMKCXNM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |