C22H22Cl2N4O2 — CID 50841318
N-[(3-chlorophenyl)methyl]-2-[4-(4-chlorophenyl)-3-morpholin-4-ylpyrazol-1-yl]acetamide (PubChem CID 50841318) has the molecular formula C22H22Cl2N4O2 and a molecular weight of 445.35 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-2-[4-(4-chlorophenyl)-3-morpholin-4-ylpyrazol-1-yl]acetamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-2-[4-(4-chlorophenyl)-3-morpholin-4-ylpyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 50841318 |
| Molecular Formula | C22H22Cl2N4O2 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-2-[4-(4-chlorophenyl)-3-morpholin-4-ylpyrazol-1-yl]acetamide |
| SMILES | O=C(Cn1cc(-c2ccc(Cl)cc2)c(N2CCOCC2)n1)NCc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H22Cl2N4O2/c23-18-6-4-17(5-7-18)20-14-28(26-22(20)27-8-10-30-11-9-27)15-21(29)25-13-16-2-1-3-19(24)12-16/h1-7,12,14H,8-11,13,15H2,(H,25,29) |
| InChIKey | UMFAYTNDFBAZFH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |