C20H26FN5OS — CID 50841354
N-butyl-2-[6-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-4-yl]sulfanylacetamide (PubChem CID 50841354) has the molecular formula C20H26FN5OS and a molecular weight of 403.53 g/mol. Its IUPAC name is N-butyl-2-[6-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-4-yl]sulfanylacetamide.
| Compound Name | N-butyl-2-[6-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-4-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 50841354 |
| Molecular Formula | C20H26FN5OS |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | N-butyl-2-[6-[4-(2-fluorophenyl)piperazin-1-yl]pyrimidin-4-yl]sulfanylacetamide |
| SMILES | CCCCNC(=O)CSc1cc(N2CCN(c3ccccc3F)CC2)ncn1 |
| InChI | InChI=1S/C20H26FN5OS/c1-2-3-8-22-19(27)14-28-20-13-18(23-15-24-20)26-11-9-25(10-12-26)17-7-5-4-6-16(17)21/h4-7,13,15H,2-3,8-12,14H2,1H3,(H,22,27) |
| InChIKey | QYMZYINYLKLCJS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|