C21H27N5O2 — CID 50842368
1-[5-[(2-ethylphenyl)carbamoylamino]-2-pyridinyl]-N-methylpiperidine-3-carboxamide (PubChem CID 50842368) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 1-[5-[(2-ethylphenyl)carbamoylamino]-2-pyridinyl]-N-methylpiperidine-3-carboxamide.
| Compound Name | 1-[5-[(2-ethylphenyl)carbamoylamino]-2-pyridinyl]-N-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 50842368 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 1-[5-[(2-ethylphenyl)carbamoylamino]-2-pyridinyl]-N-methylpiperidine-3-carboxamide |
| SMILES | CCc1ccccc1NC(=O)Nc1ccc(N2CCCC(C(=O)NC)C2)nc1 |
| InChI | InChI=1S/C21H27N5O2/c1-3-15-7-4-5-9-18(15)25-21(28)24-17-10-11-19(23-13-17)26-12-6-8-16(14-26)20(27)22-2/h4-5,7,9-11,13,16H,3,6,8,12,14H2,1-2H3,(H,22,27)(H2,24,25,28) |
| InChIKey | FKWIFRTVNVBFIV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |