C20H25ClN4O3S — CID 50842397
1-[3-[(3-chlorophenyl)sulfonylamino]-2-pyridinyl]-N-propylpiperidine-3-carboxamide (PubChem CID 50842397) has the molecular formula C20H25ClN4O3S and a molecular weight of 436.97 g/mol. Its IUPAC name is 1-[3-[(3-chlorophenyl)sulfonylamino]-2-pyridinyl]-N-propylpiperidine-3-carboxamide.
| Compound Name | 1-[3-[(3-chlorophenyl)sulfonylamino]-2-pyridinyl]-N-propylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 50842397 |
| Molecular Formula | C20H25ClN4O3S |
| Molecular Weight | 436.97 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 1-[3-[(3-chlorophenyl)sulfonylamino]-2-pyridinyl]-N-propylpiperidine-3-carboxamide |
| SMILES | CCCNC(=O)C1CCCN(c2ncccc2NS(=O)(=O)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C20H25ClN4O3S/c1-2-10-23-20(26)15-6-5-12-25(14-15)19-18(9-4-11-22-19)24-29(27,28)17-8-3-7-16(21)13-17/h3-4,7-9,11,13,15,24H,2,5-6,10,12,14H2,1H3,(H,23,26) |
| InChIKey | SPNFNLISLIGAQA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.97 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |