C24H21N3O5 — CID 50843852
(E)-N-[4-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methoxy]phenyl]-3-(5-methylfuran-2-yl)prop-2-enamide (PubChem CID 50843852) has the molecular formula C24H21N3O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is (E)-N-[4-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methoxy]phenyl]-3-(5-methylfuran-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methoxy]phenyl]-3-(5-methylfuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 50843852 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | (E)-N-[4-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methoxy]phenyl]-3-(5-methylfuran-2-yl)prop-2-enamide |
| SMILES | COc1ccc(-c2nnc(COc3ccc(NC(=O)/C=C/c4ccc(C)o4)cc3)o2)cc1 |
| InChI | InChI=1S/C24H21N3O5/c1-16-3-8-21(31-16)13-14-22(28)25-18-6-11-20(12-7-18)30-15-23-26-27-24(32-23)17-4-9-19(29-2)10-5-17/h3-14H,15H2,1-2H3,(H,25,28)/b14-13+ |
| InChIKey | GAIXDRRZFGVOLD-BUHFOSPRSA-N |
| XLogP | 4.88 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|