C22H17ClN4O4 — CID 50844203
2-chloro-N-[4-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methoxy]phenyl]pyridine-4-carboxamide (PubChem CID 50844203) has the molecular formula C22H17ClN4O4 and a molecular weight of 436.86 g/mol. Its IUPAC name is 2-chloro-N-[4-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methoxy]phenyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[4-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methoxy]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 50844203 |
| Molecular Formula | C22H17ClN4O4 |
| Molecular Weight | 436.86 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 2-chloro-N-[4-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methoxy]phenyl]pyridine-4-carboxamide |
| SMILES | COc1ccc(-c2nnc(COc3ccc(NC(=O)c4ccnc(Cl)c4)cc3)o2)cc1 |
| InChI | InChI=1S/C22H17ClN4O4/c1-29-17-6-2-14(3-7-17)22-27-26-20(31-22)13-30-18-8-4-16(5-9-18)25-21(28)15-10-11-24-19(23)12-15/h2-12H,13H2,1H3,(H,25,28) |
| InChIKey | KSNDDWPSQFTQJS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 99.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.86 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|