C12H10ClF3N2O2 — CID 5084488
(4-chlorophenyl)-[5-hydroxy-3-methylidene-5-(trifluoromethyl)pyrazolidin-1-yl]methanone (PubChem CID 5084488) has the molecular formula C12H10ClF3N2O2 and a molecular weight of 306.67 g/mol. Its IUPAC name is (4-chlorophenyl)-[5-hydroxy-3-methylidene-5-(trifluoromethyl)pyrazolidin-1-yl]methanone.
| Compound Name | (4-chlorophenyl)-[5-hydroxy-3-methylidene-5-(trifluoromethyl)pyrazolidin-1-yl]methanone |
|---|---|
| PubChem CID | 5084488 |
| Molecular Formula | C12H10ClF3N2O2 |
| Molecular Weight | 306.67 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | (4-chlorophenyl)-[5-hydroxy-3-methylidene-5-(trifluoromethyl)pyrazolidin-1-yl]methanone |
| SMILES | C=C1CC(O)(C(F)(F)F)N(C(=O)c2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C12H10ClF3N2O2/c1-7-6-11(20,12(14,15)16)18(17-7)10(19)8-2-4-9(13)5-3-8/h2-5,17,20H,1,6H2 |
| InChIKey | HCCBUICNDNFCFE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.67 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |