C21H23N7O2S — CID 50844971
N-(2,4-dimethylphenyl)-2-(5-oxo-11-piperidin-1-yl-12-thia-3,4,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl)acetamide (PubChem CID 50844971) has the molecular formula C21H23N7O2S and a molecular weight of 437.53 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-(5-oxo-11-piperidin-1-yl-12-thia-3,4,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl)acetamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-(5-oxo-11-piperidin-1-yl-12-thia-3,4,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl)acetamide |
|---|---|
| PubChem CID | 50844971 |
| Molecular Formula | C21H23N7O2S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-(5-oxo-11-piperidin-1-yl-12-thia-3,4,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,7,10-tetraen-4-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2nc3c4sc(N5CCCCC5)nc4ncn3c2=O)c(C)c1 |
| InChI | InChI=1S/C21H23N7O2S/c1-13-6-7-15(14(2)10-13)23-16(29)11-28-21(30)27-12-22-18-17(19(27)25-28)31-20(24-18)26-8-4-3-5-9-26/h6-7,10,12H,3-5,8-9,11H2,1-2H3,(H,23,29) |
| InChIKey | NZISFVLCPKFQLD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |