C22H23N5O2S — CID 53043522
N-(2,5-dimethylphenyl)-2-(14-oxo-9-thia-11,13,15,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,16-tetraen-15-yl)acetamide (PubChem CID 53043522) has the molecular formula C22H23N5O2S and a molecular weight of 421.53 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-(14-oxo-9-thia-11,13,15,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,16-tetraen-15-yl)acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-(14-oxo-9-thia-11,13,15,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,16-tetraen-15-yl)acetamide |
|---|---|
| PubChem CID | 53043522 |
| Molecular Formula | C22H23N5O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-(14-oxo-9-thia-11,13,15,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,16-tetraen-15-yl)acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)Cn2nc3c4c5c(sc4ncn3c2=O)CCCCC5)c1 |
| InChI | InChI=1S/C22H23N5O2S/c1-13-8-9-14(2)16(10-13)24-18(28)11-27-22(29)26-12-23-21-19(20(26)25-27)15-6-4-3-5-7-17(15)30-21/h8-10,12H,3-7,11H2,1-2H3,(H,24,28) |
| InChIKey | JTQICKCSIMSQCX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |