C20H18ClN5O2S — CID 53074258
N-(3-chlorophenyl)-2-(14-oxo-9-thia-11,13,15,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,16-tetraen-15-yl)acetamide (PubChem CID 53074258) has the molecular formula C20H18ClN5O2S and a molecular weight of 427.92 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(14-oxo-9-thia-11,13,15,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,16-tetraen-15-yl)acetamide.
| Compound Name | N-(3-chlorophenyl)-2-(14-oxo-9-thia-11,13,15,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,16-tetraen-15-yl)acetamide |
|---|---|
| PubChem CID | 53074258 |
| Molecular Formula | C20H18ClN5O2S |
| Molecular Weight | 427.92 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | N-(3-chlorophenyl)-2-(14-oxo-9-thia-11,13,15,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,16-tetraen-15-yl)acetamide |
| SMILES | O=C(Cn1nc2c3c4c(sc3ncn2c1=O)CCCCC4)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H18ClN5O2S/c21-12-5-4-6-13(9-12)23-16(27)10-26-20(28)25-11-22-19-17(18(25)24-26)14-7-2-1-3-8-15(14)29-19/h4-6,9,11H,1-3,7-8,10H2,(H,23,27) |
| InChIKey | JBFLQDXWPIPHEJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.92 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |