C24H27N5O2S — CID 53074282
N-(4-butylphenyl)-2-(14-oxo-9-thia-11,13,15,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,16-tetraen-15-yl)acetamide (PubChem CID 53074282) has the molecular formula C24H27N5O2S and a molecular weight of 449.58 g/mol. Its IUPAC name is N-(4-butylphenyl)-2-(14-oxo-9-thia-11,13,15,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,16-tetraen-15-yl)acetamide.
| Compound Name | N-(4-butylphenyl)-2-(14-oxo-9-thia-11,13,15,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,16-tetraen-15-yl)acetamide |
|---|---|
| PubChem CID | 53074282 |
| Molecular Formula | C24H27N5O2S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | N-(4-butylphenyl)-2-(14-oxo-9-thia-11,13,15,16-tetrazatetracyclo[8.7.0.02,8.013,17]heptadeca-1(10),2(8),11,16-tetraen-15-yl)acetamide |
| SMILES | CCCCc1ccc(NC(=O)Cn2nc3c4c5c(sc4ncn3c2=O)CCCCC5)cc1 |
| InChI | InChI=1S/C24H27N5O2S/c1-2-3-7-16-10-12-17(13-11-16)26-20(30)14-29-24(31)28-15-25-23-21(22(28)27-29)18-8-5-4-6-9-19(18)32-23/h10-13,15H,2-9,14H2,1H3,(H,26,30) |
| InChIKey | HZHOXFBTNJJZJM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |