C20H18FN5O2S — CID 53043586
N-(2-fluoro-4-methylphenyl)-2-(5-oxo-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraen-4-yl)acetamide (PubChem CID 53043586) has the molecular formula C20H18FN5O2S and a molecular weight of 411.46 g/mol. Its IUPAC name is N-(2-fluoro-4-methylphenyl)-2-(5-oxo-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraen-4-yl)acetamide.
| Compound Name | N-(2-fluoro-4-methylphenyl)-2-(5-oxo-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraen-4-yl)acetamide |
|---|---|
| PubChem CID | 53043586 |
| Molecular Formula | C20H18FN5O2S |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | N-(2-fluoro-4-methylphenyl)-2-(5-oxo-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraen-4-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2nc3c4c5c(sc4ncn3c2=O)CCCC5)c(F)c1 |
| InChI | InChI=1S/C20H18FN5O2S/c1-11-6-7-14(13(21)8-11)23-16(27)9-26-20(28)25-10-22-19-17(18(25)24-26)12-4-2-3-5-15(12)29-19/h6-8,10H,2-5,9H2,1H3,(H,23,27) |
| InChIKey | XHKKZPARLRXHRQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |