C16H11ClFNO2S — CID 50845819
N-(4-chlorophenyl)-4-fluoro-3-methoxy-1-benzothiophene-2-carboxamide (PubChem CID 50845819) has the molecular formula C16H11ClFNO2S and a molecular weight of 335.79 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-fluoro-3-methoxy-1-benzothiophene-2-carboxamide.
| Compound Name | N-(4-chlorophenyl)-4-fluoro-3-methoxy-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 50845819 |
| Molecular Formula | C16H11ClFNO2S |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | N-(4-chlorophenyl)-4-fluoro-3-methoxy-1-benzothiophene-2-carboxamide |
| SMILES | COc1c(C(=O)Nc2ccc(Cl)cc2)sc2cccc(F)c12 |
| InChI | InChI=1S/C16H11ClFNO2S/c1-21-14-13-11(18)3-2-4-12(13)22-15(14)16(20)19-10-7-5-9(17)6-8-10/h2-8H,1H3,(H,19,20) |
| InChIKey | QRTLQFSJHWATQO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |