About methyl 7-(2,2-dimethylpropanoyloxy)-3-oxononanoate
methyl 7-(2,2-dimethylpropanoyloxy)-3-oxononanoate (PubChem CID 508466) has the molecular formula C15H26O5
and a molecular weight of 286.37 g/mol. Its IUPAC name is methyl 7-(2,2-dimethylpropanoyloxy)-3-oxononanoate.
Molecular Properties
| Compound Name | methyl 7-(2,2-dimethylpropanoyloxy)-3-oxononanoate |
| PubChem CID | 508466 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | methyl 7-(2,2-dimethylpropanoyloxy)-3-oxononanoate |
| SMILES | CCC(CCCC(=O)CC(=O)OC)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C15H26O5/c1-6-12(20-14(18)15(2,3)4)9-7-8-11(16)10-13(17)19-5/h12H,6-10H2,1-5H3 |
| InChIKey | HASQLEZVJKNNCF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-(2,2-dimethylpropanoyloxy)-3-oxononanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-(2,2-dimethylpropanoyloxy)-3-oxononanoate?
The IUPAC name of methyl 7-(2,2-dimethylpropanoyloxy)-3-oxononanoate (CID 508466) is methyl 7-(2,2-dimethylpropanoyloxy)-3-oxononanoate.
What is the SMILES notation for methyl 7-(2,2-dimethylpropanoyloxy)-3-oxononanoate?
The canonical SMILES for methyl 7-(2,2-dimethylpropanoyloxy)-3-oxononanoate is CCC(CCCC(=O)CC(=O)OC)OC(=O)C(C)(C)C.
What is the InChIKey of methyl 7-(2,2-dimethylpropanoyloxy)-3-oxononanoate?
The InChIKey is HASQLEZVJKNNCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O5/c1-6-12(20-14(18)15(2,3)4)9-7-8-11(16)10-13(17)19-5/h12H,6-10H2,1-5H3.
What are the key properties of methyl 7-(2,2-dimethylpropanoyloxy)-3-oxononanoate?
methyl 7-(2,2-dimethylpropanoyloxy)-3-oxononanoate has a molecular weight of 286.37 g/mol, XLogP of 2.66, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-(2,2-dimethylpropanoyloxy)-3-oxononanoate is sourced from PubChem (CID 508466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).