C21H27N5O3S — CID 50846879
1-(2-ethylphenyl)-3-[2-[5-(propan-2-ylsulfamoyl)benzimidazol-1-yl]ethyl]urea (PubChem CID 50846879) has the molecular formula C21H27N5O3S and a molecular weight of 429.55 g/mol. Its IUPAC name is 1-(2-ethylphenyl)-3-[2-[5-(propan-2-ylsulfamoyl)benzimidazol-1-yl]ethyl]urea.
| Compound Name | 1-(2-ethylphenyl)-3-[2-[5-(propan-2-ylsulfamoyl)benzimidazol-1-yl]ethyl]urea |
|---|---|
| PubChem CID | 50846879 |
| Molecular Formula | C21H27N5O3S |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 1-(2-ethylphenyl)-3-[2-[5-(propan-2-ylsulfamoyl)benzimidazol-1-yl]ethyl]urea |
| SMILES | CCc1ccccc1NC(=O)NCCn1cnc2cc(S(=O)(=O)NC(C)C)ccc21 |
| InChI | InChI=1S/C21H27N5O3S/c1-4-16-7-5-6-8-18(16)24-21(27)22-11-12-26-14-23-19-13-17(9-10-20(19)26)30(28,29)25-15(2)3/h5-10,13-15,25H,4,11-12H2,1-3H3,(H2,22,24,27) |
| InChIKey | PUGAHKOZFNSKKI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |