C23H24N4O3 — CID 50848619
N-[5-(1-ethyl-4-methoxyindol-2-yl)-1H-pyrazol-3-yl]-2-phenylmethoxyacetamide (PubChem CID 50848619) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-[5-(1-ethyl-4-methoxyindol-2-yl)-1H-pyrazol-3-yl]-2-phenylmethoxyacetamide.
| Compound Name | N-[5-(1-ethyl-4-methoxyindol-2-yl)-1H-pyrazol-3-yl]-2-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 50848619 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | N-[5-(1-ethyl-4-methoxyindol-2-yl)-1H-pyrazol-3-yl]-2-phenylmethoxyacetamide |
| SMILES | CCn1c(-c2cc(NC(=O)COCc3ccccc3)n[nH]2)cc2c(OC)cccc21 |
| InChI | InChI=1S/C23H24N4O3/c1-3-27-19-10-7-11-21(29-2)17(19)12-20(27)18-13-22(26-25-18)24-23(28)15-30-14-16-8-5-4-6-9-16/h4-13H,3,14-15H2,1-2H3,(H2,24,25,26,28) |
| InChIKey | QJYOJCOXONYCKI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |