C25H28N4O3 — CID 53196058
3,4-diethoxy-N-[5-(1-ethyl-3-methylindol-2-yl)-1H-pyrazol-3-yl]benzamide (PubChem CID 53196058) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is 3,4-diethoxy-N-[5-(1-ethyl-3-methylindol-2-yl)-1H-pyrazol-3-yl]benzamide.
| Compound Name | 3,4-diethoxy-N-[5-(1-ethyl-3-methylindol-2-yl)-1H-pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 53196058 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 3,4-diethoxy-N-[5-(1-ethyl-3-methylindol-2-yl)-1H-pyrazol-3-yl]benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2cc(-c3c(C)c4ccccc4n3CC)[nH]n2)cc1OCC |
| InChI | InChI=1S/C25H28N4O3/c1-5-29-20-11-9-8-10-18(20)16(4)24(29)19-15-23(28-27-19)26-25(30)17-12-13-21(31-6-2)22(14-17)32-7-3/h8-15H,5-7H2,1-4H3,(H2,26,27,28,30) |
| InChIKey | ORYNLZADBNTNDP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|