C21H22ClN3O — CID 50854834
(E)-N-(3-chloro-2-methylphenyl)-2-cyano-3-(1-cyclohexylpyrrol-3-yl)prop-2-enamide (PubChem CID 50854834) has the molecular formula C21H22ClN3O and a molecular weight of 367.88 g/mol. Its IUPAC name is (E)-N-(3-chloro-2-methylphenyl)-2-cyano-3-(1-cyclohexylpyrrol-3-yl)prop-2-enamide.
| Compound Name | (E)-N-(3-chloro-2-methylphenyl)-2-cyano-3-(1-cyclohexylpyrrol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 50854834 |
| Molecular Formula | C21H22ClN3O |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | (E)-N-(3-chloro-2-methylphenyl)-2-cyano-3-(1-cyclohexylpyrrol-3-yl)prop-2-enamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)/C(C#N)=C/c1ccn(C2CCCCC2)c1 |
| InChI | InChI=1S/C21H22ClN3O/c1-15-19(22)8-5-9-20(15)24-21(26)17(13-23)12-16-10-11-25(14-16)18-6-3-2-4-7-18/h5,8-12,14,18H,2-4,6-7H2,1H3,(H,24,26)/b17-12+ |
| InChIKey | UFLDKZBPWJMAGB-SFQUDFHCSA-N |
| XLogP | 5.50 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|