C15H16BrN3O2 — CID 50855525
2-(3-bromophenoxy)-N-[(Z)-(1,5-dimethylpyrrol-2-yl)methylideneamino]acetamide (PubChem CID 50855525) has the molecular formula C15H16BrN3O2 and a molecular weight of 350.22 g/mol. Its IUPAC name is 2-(3-bromophenoxy)-N-[(Z)-(1,5-dimethylpyrrol-2-yl)methylideneamino]acetamide.
| Compound Name | 2-(3-bromophenoxy)-N-[(Z)-(1,5-dimethylpyrrol-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 50855525 |
| Molecular Formula | C15H16BrN3O2 |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 2-(3-bromophenoxy)-N-[(Z)-(1,5-dimethylpyrrol-2-yl)methylideneamino]acetamide |
| SMILES | Cc1ccc(/C=N\NC(=O)COc2cccc(Br)c2)n1C |
| InChI | InChI=1S/C15H16BrN3O2/c1-11-6-7-13(19(11)2)9-17-18-15(20)10-21-14-5-3-4-12(16)8-14/h3-9H,10H2,1-2H3,(H,18,20)/b17-9- |
| InChIKey | LTSFYDNYYDRNOX-MFOYZWKCSA-N |
| XLogP | 2.63 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|