C16H19N3O2S — CID 50855547
N-[(Z)-(1,5-dimethylpyrrol-2-yl)methylideneamino]-2-(4-methoxyphenyl)sulfanylacetamide (PubChem CID 50855547) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is N-[(Z)-(1,5-dimethylpyrrol-2-yl)methylideneamino]-2-(4-methoxyphenyl)sulfanylacetamide.
| Compound Name | N-[(Z)-(1,5-dimethylpyrrol-2-yl)methylideneamino]-2-(4-methoxyphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 50855547 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-[(Z)-(1,5-dimethylpyrrol-2-yl)methylideneamino]-2-(4-methoxyphenyl)sulfanylacetamide |
| SMILES | COc1ccc(SCC(=O)N/N=C\c2ccc(C)n2C)cc1 |
| InChI | InChI=1S/C16H19N3O2S/c1-12-4-5-13(19(12)2)10-17-18-16(20)11-22-15-8-6-14(21-3)7-9-15/h4-10H,11H2,1-3H3,(H,18,20)/b17-10- |
| InChIKey | VJDJQJLSIVFXMM-YVLHZVERSA-N |
| XLogP | 2.58 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|