C20H21N3O — CID 50855638
4-[[1-(4-methoxyphenyl)pyrrol-3-yl]methylideneamino]-N,N-dimethylaniline (PubChem CID 50855638) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is 4-[[1-(4-methoxyphenyl)pyrrol-3-yl]methylideneamino]-N,N-dimethylaniline.
| Compound Name | 4-[[1-(4-methoxyphenyl)pyrrol-3-yl]methylideneamino]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 50855638 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 4-[[1-(4-methoxyphenyl)pyrrol-3-yl]methylideneamino]-N,N-dimethylaniline |
| SMILES | COc1ccc(-n2ccc(/C=N/c3ccc(N(C)C)cc3)c2)cc1 |
| InChI | InChI=1S/C20H21N3O/c1-22(2)18-6-4-17(5-7-18)21-14-16-12-13-23(15-16)19-8-10-20(24-3)11-9-19/h4-15H,1-3H3/b21-14+ |
| InChIKey | OKAGPZHUAMOQCD-KGENOOAVSA-N |
| XLogP | 4.30 |
| TPSA | 29.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|