C20H18N2O3 — CID 50856715
3-[[1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]methylideneamino]benzoic acid (PubChem CID 50856715) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 3-[[1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]methylideneamino]benzoic acid.
| Compound Name | 3-[[1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 50856715 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 3-[[1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]methylideneamino]benzoic acid |
| SMILES | COc1ccc(-n2c(C)ccc2/C=N/c2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C20H18N2O3/c1-14-6-7-18(22(14)17-8-10-19(25-2)11-9-17)13-21-16-5-3-4-15(12-16)20(23)24/h3-13H,1-2H3,(H,23,24)/b21-13+ |
| InChIKey | YEGOTXPJWBYGLI-FYJGNVAPSA-N |
| XLogP | 4.24 |
| TPSA | 63.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|