C35H39N3O4 — CID 50865786
(5Z)-1-[4-(1-adamantyl)phenyl]-5-[(7-methoxy-1,2,2,4-tetramethylquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 50865786) has the molecular formula C35H39N3O4 and a molecular weight of 565.71 g/mol. Its IUPAC name is (5Z)-1-[4-(1-adamantyl)phenyl]-5-[(7-methoxy-1,2,2,4-tetramethylquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-1-[4-(1-adamantyl)phenyl]-5-[(7-methoxy-1,2,2,4-tetramethylquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 50865786 |
| Molecular Formula | C35H39N3O4 |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 565.29 |
| IUPAC Name | (5Z)-1-[4-(1-adamantyl)phenyl]-5-[(7-methoxy-1,2,2,4-tetramethylquinolin-6-yl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1cc2c(cc1/C=C1/C(=O)NC(=O)N(c3ccc(C45CC6CC(CC(C6)C4)C5)cc3)C1=O)C(C)=CC(C)(C)N2C |
| InChI | InChI=1S/C35H39N3O4/c1-20-16-34(2,3)37(4)29-15-30(42-5)24(13-27(20)29)14-28-31(39)36-33(41)38(32(28)40)26-8-6-25(7-9-26)35-17-21-10-22(18-35)12-23(11-21)19-35/h6-9,13-16,21-23H,10-12,17-19H2,1-5H3,(H,36,39,41)/b28-14- |
| InChIKey | YWCGAQIDUXTFHW-MUXKCCDJSA-N |
| XLogP | 6.46 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|