C24H33N3O6 — CID 5087679
N-[(1-butylbenzimidazol-2-yl)methyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide (PubChem CID 5087679) has the molecular formula C24H33N3O6 and a molecular weight of 459.54 g/mol. Its IUPAC name is N-[(1-butylbenzimidazol-2-yl)methyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide.
| Compound Name | N-[(1-butylbenzimidazol-2-yl)methyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
|---|---|
| PubChem CID | 5087679 |
| Molecular Formula | C24H33N3O6 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | N-[(1-butylbenzimidazol-2-yl)methyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
| SMILES | CCCCn1c(CNC(=O)C2OC3OC(C)(C)OC3C3OC(C)(C)OC23)nc2ccccc21 |
| InChI | InChI=1S/C24H33N3O6/c1-6-7-12-27-15-11-9-8-10-14(15)26-16(27)13-25-21(28)19-17-18(31-23(2,3)30-17)20-22(29-19)33-24(4,5)32-20/h8-11,17-20,22H,6-7,12-13H2,1-5H3,(H,25,28) |
| InChIKey | BVKRPFOMWSMOSO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 93.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |