C25H35N3O6 — CID 5087680
4,4,11,11-tetramethyl-N-[[1-(3-methylbutyl)benzimidazol-2-yl]methyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide (PubChem CID 5087680) has the molecular formula C25H35N3O6 and a molecular weight of 473.57 g/mol. Its IUPAC name is 4,4,11,11-tetramethyl-N-[[1-(3-methylbutyl)benzimidazol-2-yl]methyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide.
| Compound Name | 4,4,11,11-tetramethyl-N-[[1-(3-methylbutyl)benzimidazol-2-yl]methyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
|---|---|
| PubChem CID | 5087680 |
| Molecular Formula | C25H35N3O6 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | 4,4,11,11-tetramethyl-N-[[1-(3-methylbutyl)benzimidazol-2-yl]methyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
| SMILES | CC(C)CCn1c(CNC(=O)C2OC3OC(C)(C)OC3C3OC(C)(C)OC23)nc2ccccc21 |
| InChI | InChI=1S/C25H35N3O6/c1-14(2)11-12-28-16-10-8-7-9-15(16)27-17(28)13-26-22(29)20-18-19(32-24(3,4)31-18)21-23(30-20)34-25(5,6)33-21/h7-10,14,18-21,23H,11-13H2,1-6H3,(H,26,29) |
| InChIKey | ILYJYSBHVSRYQM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 93.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |