C13H12F3NO2 — CID 50877449
2-[2-methyl-6-(trifluoromethyl)quinolin-4-yl]oxyethanol (PubChem CID 50877449) has the molecular formula C13H12F3NO2 and a molecular weight of 271.24 g/mol. Its IUPAC name is 2-[2-methyl-6-(trifluoromethyl)quinolin-4-yl]oxyethanol.
| Compound Name | 2-[2-methyl-6-(trifluoromethyl)quinolin-4-yl]oxyethanol |
|---|---|
| PubChem CID | 50877449 |
| Molecular Formula | C13H12F3NO2 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-[2-methyl-6-(trifluoromethyl)quinolin-4-yl]oxyethanol |
| SMILES | Cc1cc(OCCO)c2cc(C(F)(F)F)ccc2n1 |
| InChI | InChI=1S/C13H12F3NO2/c1-8-6-12(19-5-4-18)10-7-9(13(14,15)16)2-3-11(10)17-8/h2-3,6-7,18H,4-5H2,1H3 |
| InChIKey | FAPGMMORJGDNMI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |