C14H16ClN3O4 — CID 50879714
1-[2-(2-methyl-4-nitroanilino)ethyl]-5-oxopyrrolidine-3-carbonyl chloride (PubChem CID 50879714) has the molecular formula C14H16ClN3O4 and a molecular weight of 325.75 g/mol. Its IUPAC name is 1-[2-(2-methyl-4-nitroanilino)ethyl]-5-oxopyrrolidine-3-carbonyl chloride.
| Compound Name | 1-[2-(2-methyl-4-nitroanilino)ethyl]-5-oxopyrrolidine-3-carbonyl chloride |
|---|---|
| PubChem CID | 50879714 |
| Molecular Formula | C14H16ClN3O4 |
| Molecular Weight | 325.75 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 1-[2-(2-methyl-4-nitroanilino)ethyl]-5-oxopyrrolidine-3-carbonyl chloride |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NCCN1CC(C(=O)Cl)CC1=O |
| InChI | InChI=1S/C14H16ClN3O4/c1-9-6-11(18(21)22)2-3-12(9)16-4-5-17-8-10(14(15)20)7-13(17)19/h2-3,6,10,16H,4-5,7-8H2,1H3 |
| InChIKey | SQHZTNZTCZQYIL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.75 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|