C17H15FN4O — CID 50881395
N-[2,6-dimethyl-4-(1,2,4-triazol-4-yl)phenyl]-4-fluorobenzamide (PubChem CID 50881395) has the molecular formula C17H15FN4O and a molecular weight of 310.33 g/mol. Its IUPAC name is N-[2,6-dimethyl-4-(1,2,4-triazol-4-yl)phenyl]-4-fluorobenzamide.
| Compound Name | N-[2,6-dimethyl-4-(1,2,4-triazol-4-yl)phenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 50881395 |
| Molecular Formula | C17H15FN4O |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | N-[2,6-dimethyl-4-(1,2,4-triazol-4-yl)phenyl]-4-fluorobenzamide |
| SMILES | Cc1cc(-n2cnnc2)cc(C)c1NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H15FN4O/c1-11-7-15(22-9-19-20-10-22)8-12(2)16(11)21-17(23)13-3-5-14(18)6-4-13/h3-10H,1-2H3,(H,21,23) |
| InChIKey | PVLCVQDOUWFVEJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |