C15H12N4O2 — CID 6459181
N-(3-hydroxyphenyl)-4-(1,2,4-triazol-4-yl)benzamide (PubChem CID 6459181) has the molecular formula C15H12N4O2 and a molecular weight of 280.29 g/mol. Its IUPAC name is N-(3-hydroxyphenyl)-4-(1,2,4-triazol-4-yl)benzamide.
| Compound Name | N-(3-hydroxyphenyl)-4-(1,2,4-triazol-4-yl)benzamide |
|---|---|
| PubChem CID | 6459181 |
| Molecular Formula | C15H12N4O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | N-(3-hydroxyphenyl)-4-(1,2,4-triazol-4-yl)benzamide |
| SMILES | O=C(Nc1cccc(O)c1)c1ccc(-n2cnnc2)cc1 |
| InChI | InChI=1S/C15H12N4O2/c20-14-3-1-2-12(8-14)18-15(21)11-4-6-13(7-5-11)19-9-16-17-10-19/h1-10,20H,(H,18,21) |
| InChIKey | LFWPCFRTQZBVFZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |