C15H11ClN4O — CID 50882082
3-chloro-N-[4-(1,2,4-triazol-4-yl)phenyl]benzamide (PubChem CID 50882082) has the molecular formula C15H11ClN4O and a molecular weight of 298.73 g/mol. Its IUPAC name is 3-chloro-N-[4-(1,2,4-triazol-4-yl)phenyl]benzamide.
| Compound Name | 3-chloro-N-[4-(1,2,4-triazol-4-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 50882082 |
| Molecular Formula | C15H11ClN4O |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 3-chloro-N-[4-(1,2,4-triazol-4-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-n2cnnc2)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H11ClN4O/c16-12-3-1-2-11(8-12)15(21)19-13-4-6-14(7-5-13)20-9-17-18-10-20/h1-10H,(H,19,21) |
| InChIKey | NMEJLAMFDQYYDS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |