C17H22ClN5OS — CID 50882833
1-[4-[5-chloro-2-(2-propan-2-ylidenehydrazinyl)-1,3-benzothiazol-4-yl]piperazin-1-yl]propan-1-one (PubChem CID 50882833) has the molecular formula C17H22ClN5OS and a molecular weight of 379.92 g/mol. Its IUPAC name is 1-[4-[5-chloro-2-(2-propan-2-ylidenehydrazinyl)-1,3-benzothiazol-4-yl]piperazin-1-yl]propan-1-one.
| Compound Name | 1-[4-[5-chloro-2-(2-propan-2-ylidenehydrazinyl)-1,3-benzothiazol-4-yl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 50882833 |
| Molecular Formula | C17H22ClN5OS |
| Molecular Weight | 379.92 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 1-[4-[5-chloro-2-(2-propan-2-ylidenehydrazinyl)-1,3-benzothiazol-4-yl]piperazin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCN(c2c(Cl)ccc3sc(NN=C(C)C)nc23)CC1 |
| InChI | InChI=1S/C17H22ClN5OS/c1-4-14(24)22-7-9-23(10-8-22)16-12(18)5-6-13-15(16)19-17(25-13)21-20-11(2)3/h5-6H,4,7-10H2,1-3H3,(H,19,21) |
| InChIKey | MMZQHARMIOLNTC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 60.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.92 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|