C18H17ClFN5OS — CID 50882627
[4-(5-chloro-2-hydrazinyl-1,3-benzothiazol-4-yl)piperazin-1-yl]-(2-fluorophenyl)methanone (PubChem CID 50882627) has the molecular formula C18H17ClFN5OS and a molecular weight of 405.89 g/mol. Its IUPAC name is [4-(5-chloro-2-hydrazinyl-1,3-benzothiazol-4-yl)piperazin-1-yl]-(2-fluorophenyl)methanone.
| Compound Name | [4-(5-chloro-2-hydrazinyl-1,3-benzothiazol-4-yl)piperazin-1-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 50882627 |
| Molecular Formula | C18H17ClFN5OS |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | [4-(5-chloro-2-hydrazinyl-1,3-benzothiazol-4-yl)piperazin-1-yl]-(2-fluorophenyl)methanone |
| SMILES | NNc1nc2c(N3CCN(C(=O)c4ccccc4F)CC3)c(Cl)ccc2s1 |
| InChI | InChI=1S/C18H17ClFN5OS/c19-12-5-6-14-15(22-18(23-21)27-14)16(12)24-7-9-25(10-8-24)17(26)11-3-1-2-4-13(11)20/h1-6H,7-10,21H2,(H,22,23) |
| InChIKey | JWSOVDROCRNIQI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|