C18H18ClFN4OS — CID 50882733
[3-chloro-2-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]thiourea (PubChem CID 50882733) has the molecular formula C18H18ClFN4OS and a molecular weight of 392.89 g/mol. Its IUPAC name is [3-chloro-2-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]thiourea.
| Compound Name | [3-chloro-2-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]thiourea |
|---|---|
| PubChem CID | 50882733 |
| Molecular Formula | C18H18ClFN4OS |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | [3-chloro-2-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]thiourea |
| SMILES | NC(=S)Nc1cccc(Cl)c1N1CCN(C(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C18H18ClFN4OS/c19-13-5-3-7-15(22-18(21)26)16(13)23-8-10-24(11-9-23)17(25)12-4-1-2-6-14(12)20/h1-7H,8-11H2,(H3,21,22,26) |
| InChIKey | JJBDFFRQESUJMC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|