C15H12Br2INO — CID 50883934
1-(3,5-dibromo-2-methoxyphenyl)-N-(4-iodo-2-methylphenyl)methanimine (PubChem CID 50883934) has the molecular formula C15H12Br2INO and a molecular weight of 508.98 g/mol. Its IUPAC name is 1-(3,5-dibromo-2-methoxyphenyl)-N-(4-iodo-2-methylphenyl)methanimine.
| Compound Name | 1-(3,5-dibromo-2-methoxyphenyl)-N-(4-iodo-2-methylphenyl)methanimine |
|---|---|
| PubChem CID | 50883934 |
| Molecular Formula | C15H12Br2INO |
| Molecular Weight | 508.98 g/mol |
| Exact Mass | 506.83 |
| IUPAC Name | 1-(3,5-dibromo-2-methoxyphenyl)-N-(4-iodo-2-methylphenyl)methanimine |
| SMILES | COc1c(Br)cc(Br)cc1/C=N/c1ccc(I)cc1C |
| InChI | InChI=1S/C15H12Br2INO/c1-9-5-12(18)3-4-14(9)19-8-10-6-11(16)7-13(17)15(10)20-2/h3-8H,1-2H3/b19-8+ |
| InChIKey | IFKFNLDJYMKENM-UFWORHAWSA-N |
| XLogP | 5.88 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.98 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|