C23H20N4O2 — CID 50884801
(3Z)-2-amino-4-[3-ethoxy-4-(2-phenylethoxy)phenyl]buta-1,3-diene-1,1,3-tricarbonitrile (PubChem CID 50884801) has the molecular formula C23H20N4O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is (3Z)-2-amino-4-[3-ethoxy-4-(2-phenylethoxy)phenyl]buta-1,3-diene-1,1,3-tricarbonitrile.
| Compound Name | (3Z)-2-amino-4-[3-ethoxy-4-(2-phenylethoxy)phenyl]buta-1,3-diene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 50884801 |
| Molecular Formula | C23H20N4O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (3Z)-2-amino-4-[3-ethoxy-4-(2-phenylethoxy)phenyl]buta-1,3-diene-1,1,3-tricarbonitrile |
| SMILES | CCOc1cc(/C=C(\C#N)C(N)=C(C#N)C#N)ccc1OCCc1ccccc1 |
| InChI | InChI=1S/C23H20N4O2/c1-2-28-22-13-18(12-19(14-24)23(27)20(15-25)16-26)8-9-21(22)29-11-10-17-6-4-3-5-7-17/h3-9,12-13H,2,10-11,27H2,1H3/b19-12+ |
| InChIKey | SDQNVTUJDQNIHV-XDHOZWIPSA-N |
| XLogP | 3.87 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|