C21H22N4 — CID 5088548
2-amino-6-[4-(2-methylpropyl)phenyl]-4-(1-methylpyrrol-2-yl)pyridine-3-carbonitrile (PubChem CID 5088548) has the molecular formula C21H22N4 and a molecular weight of 330.44 g/mol. Its IUPAC name is 2-amino-6-[4-(2-methylpropyl)phenyl]-4-(1-methylpyrrol-2-yl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-6-[4-(2-methylpropyl)phenyl]-4-(1-methylpyrrol-2-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5088548 |
| Molecular Formula | C21H22N4 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 2-amino-6-[4-(2-methylpropyl)phenyl]-4-(1-methylpyrrol-2-yl)pyridine-3-carbonitrile |
| SMILES | CC(C)Cc1ccc(-c2cc(-c3cccn3C)c(C#N)c(N)n2)cc1 |
| InChI | InChI=1S/C21H22N4/c1-14(2)11-15-6-8-16(9-7-15)19-12-17(18(13-22)21(23)24-19)20-5-4-10-25(20)3/h4-10,12,14H,11H2,1-3H3,(H2,23,24) |
| InChIKey | TXZODEXBFWSRTN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |