C39H32N4O5 — CID 50886869
benzyl 3-[5-[bis(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]furan-2-yl]benzoate (PubChem CID 50886869) has the molecular formula C39H32N4O5 and a molecular weight of 636.71 g/mol. Its IUPAC name is benzyl 3-[5-[bis(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]furan-2-yl]benzoate.
| Compound Name | benzyl 3-[5-[bis(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 50886869 |
| Molecular Formula | C39H32N4O5 |
| Molecular Weight | 636.71 g/mol |
| Exact Mass | 636.24 |
| IUPAC Name | benzyl 3-[5-[bis(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methyl]furan-2-yl]benzoate |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1C(c1ccc(-c2cccc(C(=O)OCc3ccccc3)c2)o1)c1c(C)[nH]n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C39H32N4O5/c1-25-34(37(44)42(40-25)30-17-8-4-9-18-30)36(35-26(2)41-43(38(35)45)31-19-10-5-11-20-31)33-22-21-32(48-33)28-15-12-16-29(23-28)39(46)47-24-27-13-6-3-7-14-27/h3-23,36,40-41H,24H2,1-2H3 |
| InChIKey | RORKFVOZTRPVEC-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 115.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.71 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |