C16H16FN3O4S — CID 50889099
2-(N-(4-acetamidophenyl)sulfonyl-4-fluoroanilino)acetamide (PubChem CID 50889099) has the molecular formula C16H16FN3O4S and a molecular weight of 365.39 g/mol. Its IUPAC name is 2-(N-(4-acetamidophenyl)sulfonyl-4-fluoroanilino)acetamide.
| Compound Name | 2-(N-(4-acetamidophenyl)sulfonyl-4-fluoroanilino)acetamide |
|---|---|
| PubChem CID | 50889099 |
| Molecular Formula | C16H16FN3O4S |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 2-(N-(4-acetamidophenyl)sulfonyl-4-fluoroanilino)acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(CC(N)=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C16H16FN3O4S/c1-11(21)19-13-4-8-15(9-5-13)25(23,24)20(10-16(18)22)14-6-2-12(17)3-7-14/h2-9H,10H2,1H3,(H2,18,22)(H,19,21) |
| InChIKey | TVEPTOKNNVHOTC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |