C16H17BrN4O4S — CID 50889129
N-[4-[(4-bromophenyl)-(2-hydrazinyl-2-oxoethyl)sulfamoyl]phenyl]acetamide (PubChem CID 50889129) has the molecular formula C16H17BrN4O4S and a molecular weight of 441.31 g/mol. Its IUPAC name is N-[4-[(4-bromophenyl)-(2-hydrazinyl-2-oxoethyl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[(4-bromophenyl)-(2-hydrazinyl-2-oxoethyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 50889129 |
| Molecular Formula | C16H17BrN4O4S |
| Molecular Weight | 441.31 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | N-[4-[(4-bromophenyl)-(2-hydrazinyl-2-oxoethyl)sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(CC(=O)NN)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C16H17BrN4O4S/c1-11(22)19-13-4-8-15(9-5-13)26(24,25)21(10-16(23)20-18)14-6-2-12(17)3-7-14/h2-9H,10,18H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | BVMXFSGJWDTBPV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|