C16H15ClN2O5S — CID 50891800
2-(2,3-dimethyl-N-(3-nitrophenyl)sulfonylanilino)acetyl chloride (PubChem CID 50891800) has the molecular formula C16H15ClN2O5S and a molecular weight of 382.83 g/mol. Its IUPAC name is 2-(2,3-dimethyl-N-(3-nitrophenyl)sulfonylanilino)acetyl chloride.
| Compound Name | 2-(2,3-dimethyl-N-(3-nitrophenyl)sulfonylanilino)acetyl chloride |
|---|---|
| PubChem CID | 50891800 |
| Molecular Formula | C16H15ClN2O5S |
| Molecular Weight | 382.83 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 2-(2,3-dimethyl-N-(3-nitrophenyl)sulfonylanilino)acetyl chloride |
| SMILES | Cc1cccc(N(CC(=O)Cl)S(=O)(=O)c2cccc([N+](=O)[O-])c2)c1C |
| InChI | InChI=1S/C16H15ClN2O5S/c1-11-5-3-8-15(12(11)2)18(10-16(17)20)25(23,24)14-7-4-6-13(9-14)19(21)22/h3-9H,10H2,1-2H3 |
| InChIKey | JZAOKNFRAXCQQD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.83 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|