C13H18ClNO3S — CID 50891943
2-(N-ethylsulfonyl-2,4,6-trimethylanilino)acetyl chloride (PubChem CID 50891943) has the molecular formula C13H18ClNO3S and a molecular weight of 303.81 g/mol. Its IUPAC name is 2-(N-ethylsulfonyl-2,4,6-trimethylanilino)acetyl chloride.
| Compound Name | 2-(N-ethylsulfonyl-2,4,6-trimethylanilino)acetyl chloride |
|---|---|
| PubChem CID | 50891943 |
| Molecular Formula | C13H18ClNO3S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-(N-ethylsulfonyl-2,4,6-trimethylanilino)acetyl chloride |
| SMILES | CCS(=O)(=O)N(CC(=O)Cl)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C13H18ClNO3S/c1-5-19(17,18)15(8-12(14)16)13-10(3)6-9(2)7-11(13)4/h6-7H,5,8H2,1-4H3 |
| InChIKey | YUMOJDMXMQCXAG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|