C12H7BrCl2N2O4S — CID 5089317
N-(2-bromo-5-nitrophenyl)-2,6-dichlorobenzenesulfonamide (PubChem CID 5089317) has the molecular formula C12H7BrCl2N2O4S and a molecular weight of 426.08 g/mol. Its IUPAC name is N-(2-bromo-5-nitrophenyl)-2,6-dichlorobenzenesulfonamide.
| Compound Name | N-(2-bromo-5-nitrophenyl)-2,6-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 5089317 |
| Molecular Formula | C12H7BrCl2N2O4S |
| Molecular Weight | 426.08 g/mol |
| Exact Mass | 423.87 |
| IUPAC Name | N-(2-bromo-5-nitrophenyl)-2,6-dichlorobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(Br)c(NS(=O)(=O)c2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C12H7BrCl2N2O4S/c13-8-5-4-7(17(18)19)6-11(8)16-22(20,21)12-9(14)2-1-3-10(12)15/h1-6,16H |
| InChIKey | NTKDIBLFOKYFHZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.08 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|