C13H18N2O7S — CID 50893989
propan-2-yl 2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetate (PubChem CID 50893989) has the molecular formula C13H18N2O7S and a molecular weight of 346.36 g/mol. Its IUPAC name is propan-2-yl 2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetate.
| Compound Name | propan-2-yl 2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetate |
|---|---|
| PubChem CID | 50893989 |
| Molecular Formula | C13H18N2O7S |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | propan-2-yl 2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetate |
| SMILES | COc1ccc([N+](=O)[O-])cc1N(CC(=O)OC(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C13H18N2O7S/c1-9(2)22-13(16)8-14(23(4,19)20)11-7-10(15(17)18)5-6-12(11)21-3/h5-7,9H,8H2,1-4H3 |
| InChIKey | BKXDEQHNBVLGHM-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|