C14H17ClN4 — CID 50896084
1-[2-chloro-4-(1,2,4-triazol-4-yl)phenyl]-4-methylpiperidine (PubChem CID 50896084) has the molecular formula C14H17ClN4 and a molecular weight of 276.77 g/mol. Its IUPAC name is 1-[2-chloro-4-(1,2,4-triazol-4-yl)phenyl]-4-methylpiperidine.
| Compound Name | 1-[2-chloro-4-(1,2,4-triazol-4-yl)phenyl]-4-methylpiperidine |
|---|---|
| PubChem CID | 50896084 |
| Molecular Formula | C14H17ClN4 |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 1-[2-chloro-4-(1,2,4-triazol-4-yl)phenyl]-4-methylpiperidine |
| SMILES | CC1CCN(c2ccc(-n3cnnc3)cc2Cl)CC1 |
| InChI | InChI=1S/C14H17ClN4/c1-11-4-6-18(7-5-11)14-3-2-12(8-13(14)15)19-9-16-17-10-19/h2-3,8-11H,4-7H2,1H3 |
| InChIKey | QTYCEBUZUWNTCR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|